C31H30ClN3O4 — CID 4835272
4-(2-chlorophenyl)-8-(3-ethoxy-4-propoxyphenyl)-2-methyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraene-3,5-dione (PubChem CID 4835272) has the molecular formula C31H30ClN3O4 and a molecular weight of 544.05 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-8-(3-ethoxy-4-propoxyphenyl)-2-methyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraene-3,5-dione.
| Compound Name | 4-(2-chlorophenyl)-8-(3-ethoxy-4-propoxyphenyl)-2-methyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraene-3,5-dione |
|---|---|
| PubChem CID | 4835272 |
| Molecular Formula | C31H30ClN3O4 |
| Molecular Weight | 544.05 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 4-(2-chlorophenyl)-8-(3-ethoxy-4-propoxyphenyl)-2-methyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraene-3,5-dione |
| SMILES | CCCOc1ccc(C2CN3C(=O)N(c4ccccc4Cl)C(=O)C3(C)c3[nH]c4ccccc4c32)cc1OCC |
| InChI | InChI=1S/C31H30ClN3O4/c1-4-16-39-25-15-14-19(17-26(25)38-5-2)21-18-34-30(37)35(24-13-9-7-11-22(24)32)29(36)31(34,3)28-27(21)20-10-6-8-12-23(20)33-28/h6-15,17,21,33H,4-5,16,18H2,1-3H3 |
| InChIKey | PHXPIVRIWKBBKZ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.05 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|