C34H37N3O4 — CID 95373311
(2S,9S)-9-(3-ethoxy-4-propoxyphenyl)-2-methyl-4-(2-phenylethyl)-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione (PubChem CID 95373311) has the molecular formula C34H37N3O4 and a molecular weight of 551.69 g/mol. Its IUPAC name is (2S,9S)-9-(3-ethoxy-4-propoxyphenyl)-2-methyl-4-(2-phenylethyl)-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione.
| Compound Name | (2S,9S)-9-(3-ethoxy-4-propoxyphenyl)-2-methyl-4-(2-phenylethyl)-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
|---|---|
| PubChem CID | 95373311 |
| Molecular Formula | C34H37N3O4 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | (2S,9S)-9-(3-ethoxy-4-propoxyphenyl)-2-methyl-4-(2-phenylethyl)-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
| SMILES | CCCOc1ccc([C@@H]2CN3C(=O)CN(CCc4ccccc4)C(=O)[C@]3(C)c3[nH]c4ccccc4c32)cc1OCC |
| InChI | InChI=1S/C34H37N3O4/c1-4-19-41-28-16-15-24(20-29(28)40-5-2)26-21-37-30(38)22-36(18-17-23-11-7-6-8-12-23)33(39)34(37,3)32-31(26)25-13-9-10-14-27(25)35-32/h6-16,20,26,35H,4-5,17-19,21-22H2,1-3H3/t26-,34-/m0/s1 |
| InChIKey | JWTMXJKQHLHWDA-JKFCTSDTSA-N |
| XLogP | 5.63 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |