C25H24ClN2O2+ — CID 2405587
(1R,4R)-4-(2-chlorophenyl)-1-(3,4-dimethoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium (PubChem CID 2405587) has the molecular formula C25H24ClN2O2+ and a molecular weight of 419.93 g/mol. Its IUPAC name is (1R,4R)-4-(2-chlorophenyl)-1-(3,4-dimethoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium.
| Compound Name | (1R,4R)-4-(2-chlorophenyl)-1-(3,4-dimethoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 2405587 |
| Molecular Formula | C25H24ClN2O2+ |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | (1R,4R)-4-(2-chlorophenyl)-1-(3,4-dimethoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
| SMILES | COc1ccc([C@H]2[NH2+]C[C@@H](c3ccccc3Cl)c3c2[nH]c2ccccc32)cc1OC |
| InChI | InChI=1S/C25H23ClN2O2/c1-29-21-12-11-15(13-22(21)30-2)24-25-23(17-8-4-6-10-20(17)28-25)18(14-27-24)16-7-3-5-9-19(16)26/h3-13,18,24,27-28H,14H2,1-2H3/p+1/t18-,24+/m0/s1 |
| InChIKey | FUOOGJQRZOPVRP-MHECFPHRSA-O |
| XLogP | 4.64 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|