C29H33N2O2+ — CID 2518560
(1R,4S)-1-[3-ethoxy-4-(2-methylpropoxy)phenyl]-4-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium (PubChem CID 2518560) has the molecular formula C29H33N2O2+ and a molecular weight of 441.60 g/mol. Its IUPAC name is (1R,4S)-1-[3-ethoxy-4-(2-methylpropoxy)phenyl]-4-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium.
| Compound Name | (1R,4S)-1-[3-ethoxy-4-(2-methylpropoxy)phenyl]-4-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 2518560 |
| Molecular Formula | C29H33N2O2+ |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | (1R,4S)-1-[3-ethoxy-4-(2-methylpropoxy)phenyl]-4-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
| SMILES | CCOc1cc([C@H]2[NH2+]C[C@@H](c3ccccc3)c3c2[nH]c2ccccc32)ccc1OCC(C)C |
| InChI | InChI=1S/C29H32N2O2/c1-4-32-26-16-21(14-15-25(26)33-18-19(2)3)28-29-27(22-12-8-9-13-24(22)31-29)23(17-30-28)20-10-6-5-7-11-20/h5-16,19,23,28,30-31H,4,17-18H2,1-3H3/p+1/t23-,28+/m0/s1 |
| InChIKey | OTJQJEUYFTUZQO-NEKDWFFYSA-O |
| XLogP | 5.40 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|