C27H31NO6 — CID 126128363
5-[(R)-[3-ethoxy-4-(2-methylpropoxy)phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 126128363) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is 5-[(R)-[3-ethoxy-4-(2-methylpropoxy)phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(R)-[3-ethoxy-4-(2-methylpropoxy)phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 126128363 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 5-[(R)-[3-ethoxy-4-(2-methylpropoxy)phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCOc1cc([C@H](c2c[nH]c3ccccc23)C2C(=O)OC(C)(C)OC2=O)ccc1OCC(C)C |
| InChI | InChI=1S/C27H31NO6/c1-6-31-22-13-17(11-12-21(22)32-15-16(2)3)23(19-14-28-20-10-8-7-9-18(19)20)24-25(29)33-27(4,5)34-26(24)30/h7-14,16,23-24,28H,6,15H2,1-5H3/t23-/m1/s1 |
| InChIKey | WXGQJUZULXRPMO-HSZRJFAPSA-N |
| XLogP | 5.19 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|