C25H26INO6 — CID 126127448
5-[(R)-(3,4-diethoxy-5-iodophenyl)-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 126127448) has the molecular formula C25H26INO6 and a molecular weight of 563.39 g/mol. Its IUPAC name is 5-[(R)-(3,4-diethoxy-5-iodophenyl)-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(R)-(3,4-diethoxy-5-iodophenyl)-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 126127448 |
| Molecular Formula | C25H26INO6 |
| Molecular Weight | 563.39 g/mol |
| Exact Mass | 563.08 |
| IUPAC Name | 5-[(R)-(3,4-diethoxy-5-iodophenyl)-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCOc1cc([C@H](c2c[nH]c3ccccc23)C2C(=O)OC(C)(C)OC2=O)cc(I)c1OCC |
| InChI | InChI=1S/C25H26INO6/c1-5-30-19-12-14(11-17(26)22(19)31-6-2)20(16-13-27-18-10-8-7-9-15(16)18)21-23(28)32-25(3,4)33-24(21)29/h7-13,20-21,27H,5-6H2,1-4H3/t20-/m1/s1 |
| InChIKey | YOFZQKJMJRREIG-HXUWFJFHSA-N |
| XLogP | 5.15 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.39 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|