C28H22Cl3NO5 — CID 126116226
5-[(R)-[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 126116226) has the molecular formula C28H22Cl3NO5 and a molecular weight of 558.85 g/mol. Its IUPAC name is 5-[(R)-[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(R)-[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 126116226 |
| Molecular Formula | C28H22Cl3NO5 |
| Molecular Weight | 558.85 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | 5-[(R)-[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C([C@H](c2cc(Cl)c(OCc3ccccc3Cl)c(Cl)c2)c2c[nH]c3ccccc23)C(=O)O1 |
| InChI | InChI=1S/C28H22Cl3NO5/c1-28(2)36-26(33)24(27(34)37-28)23(18-13-32-22-10-6-4-8-17(18)22)16-11-20(30)25(21(31)12-16)35-14-15-7-3-5-9-19(15)29/h3-13,23-24,32H,14H2,1-2H3/t23-/m1/s1 |
| InChIKey | NRZPVKQZMHNYKW-HSZRJFAPSA-N |
| XLogP | 7.29 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.85 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|