C29H22Cl2N2O5 — CID 126116030
2-[[2,6-dichloro-4-[(S)-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-(1H-indol-3-yl)methyl]phenoxy]methyl]benzonitrile (PubChem CID 126116030) has the molecular formula C29H22Cl2N2O5 and a molecular weight of 549.41 g/mol. Its IUPAC name is 2-[[2,6-dichloro-4-[(S)-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-(1H-indol-3-yl)methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2,6-dichloro-4-[(S)-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-(1H-indol-3-yl)methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126116030 |
| Molecular Formula | C29H22Cl2N2O5 |
| Molecular Weight | 549.41 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | 2-[[2,6-dichloro-4-[(S)-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-(1H-indol-3-yl)methyl]phenoxy]methyl]benzonitrile |
| SMILES | CC1(C)OC(=O)C([C@@H](c2cc(Cl)c(OCc3ccccc3C#N)c(Cl)c2)c2c[nH]c3ccccc23)C(=O)O1 |
| InChI | InChI=1S/C29H22Cl2N2O5/c1-29(2)37-27(34)25(28(35)38-29)24(20-14-33-23-10-6-5-9-19(20)23)18-11-21(30)26(22(31)12-18)36-15-17-8-4-3-7-16(17)13-32/h3-12,14,24-25,33H,15H2,1-2H3/t24-/m0/s1 |
| InChIKey | JOBOTUFPFNUFSH-DEOSSOPVSA-N |
| XLogP | 6.51 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.41 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|