C28H23ClFNO5 — CID 126128867
5-[(S)-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 126128867) has the molecular formula C28H23ClFNO5 and a molecular weight of 507.95 g/mol. Its IUPAC name is 5-[(S)-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(S)-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 126128867 |
| Molecular Formula | C28H23ClFNO5 |
| Molecular Weight | 507.95 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 5-[(S)-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C([C@@H](c2ccc(OCc3cccc(F)c3)c(Cl)c2)c2c[nH]c3ccccc23)C(=O)O1 |
| InChI | InChI=1S/C28H23ClFNO5/c1-28(2)35-26(32)25(27(33)36-28)24(20-14-31-22-9-4-3-8-19(20)22)17-10-11-23(21(29)13-17)34-15-16-6-5-7-18(30)12-16/h3-14,24-25,31H,15H2,1-2H3/t24-/m0/s1 |
| InChIKey | ZMBMGIPKTQDRID-DEOSSOPVSA-N |
| XLogP | 6.12 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.95 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|