C29H26FNO6 — CID 126126962
5-[(S)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 126126962) has the molecular formula C29H26FNO6 and a molecular weight of 503.53 g/mol. Its IUPAC name is 5-[(S)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(S)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 126126962 |
| Molecular Formula | C29H26FNO6 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 5-[(S)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1cc([C@@H](c2c[nH]c3ccccc23)C2C(=O)OC(C)(C)OC2=O)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C29H26FNO6/c1-29(2)36-27(32)26(28(33)37-29)25(20-15-31-22-11-7-5-9-19(20)22)17-12-13-23(24(14-17)34-3)35-16-18-8-4-6-10-21(18)30/h4-15,25-26,31H,16H2,1-3H3/t25-/m0/s1 |
| InChIKey | RNELXLKPUBQJRV-VWLOTQADSA-N |
| XLogP | 5.48 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|