C24H24INO6 — CID 126119730
5-[(S)-(4-ethoxy-3-iodo-5-methoxyphenyl)-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 126119730) has the molecular formula C24H24INO6 and a molecular weight of 549.36 g/mol. Its IUPAC name is 5-[(S)-(4-ethoxy-3-iodo-5-methoxyphenyl)-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(S)-(4-ethoxy-3-iodo-5-methoxyphenyl)-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 126119730 |
| Molecular Formula | C24H24INO6 |
| Molecular Weight | 549.36 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | 5-[(S)-(4-ethoxy-3-iodo-5-methoxyphenyl)-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCOc1c(I)cc([C@@H](c2c[nH]c3ccccc23)C2C(=O)OC(C)(C)OC2=O)cc1OC |
| InChI | InChI=1S/C24H24INO6/c1-5-30-21-16(25)10-13(11-18(21)29-4)19(15-12-26-17-9-7-6-8-14(15)17)20-22(27)31-24(2,3)32-23(20)28/h6-12,19-20,26H,5H2,1-4H3/t19-/m0/s1 |
| InChIKey | ATMSOTFAEPSJPE-IBGZPJMESA-N |
| XLogP | 4.76 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|