C31H30INO6 — CID 126121259
5-[(R)-[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 126121259) has the molecular formula C31H30INO6 and a molecular weight of 639.49 g/mol. Its IUPAC name is 5-[(R)-[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(R)-[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 126121259 |
| Molecular Formula | C31H30INO6 |
| Molecular Weight | 639.49 g/mol |
| Exact Mass | 639.11 |
| IUPAC Name | 5-[(R)-[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCOc1cc([C@H](c2c[nH]c3ccccc23)C2C(=O)OC(C)(C)OC2=O)cc(I)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C31H30INO6/c1-5-36-25-15-20(14-23(32)28(25)37-17-19-12-10-18(2)11-13-19)26(22-16-33-24-9-7-6-8-21(22)24)27-29(34)38-31(3,4)39-30(27)35/h6-16,26-27,33H,5,17H2,1-4H3/t26-/m1/s1 |
| InChIKey | FHUYNUTUUHEBRS-AREMUKBSSA-N |
| XLogP | 6.64 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.49 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|