C22H20BrNO5 — CID 126124002
5-[(S)-(5-bromo-2-methoxyphenyl)-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 126124002) has the molecular formula C22H20BrNO5 and a molecular weight of 458.31 g/mol. Its IUPAC name is 5-[(S)-(5-bromo-2-methoxyphenyl)-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(S)-(5-bromo-2-methoxyphenyl)-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 126124002 |
| Molecular Formula | C22H20BrNO5 |
| Molecular Weight | 458.31 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 5-[(S)-(5-bromo-2-methoxyphenyl)-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1ccc(Br)cc1[C@H](c1c[nH]c2ccccc12)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C22H20BrNO5/c1-22(2)28-20(25)19(21(26)29-22)18(14-10-12(23)8-9-17(14)27-3)15-11-24-16-7-5-4-6-13(15)16/h4-11,18-19,24H,1-3H3/t18-/m1/s1 |
| InChIKey | ONPAWFOXXPKILN-GOSISDBHSA-N |
| XLogP | 4.52 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.31 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|