C28H24ClNO5 — CID 126128110
5-[(R)-[2-[(4-chlorophenyl)methoxy]phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 126128110) has the molecular formula C28H24ClNO5 and a molecular weight of 489.96 g/mol. Its IUPAC name is 5-[(R)-[2-[(4-chlorophenyl)methoxy]phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(R)-[2-[(4-chlorophenyl)methoxy]phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 126128110 |
| Molecular Formula | C28H24ClNO5 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 5-[(R)-[2-[(4-chlorophenyl)methoxy]phenyl]-(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C([C@@H](c2ccccc2OCc2ccc(Cl)cc2)c2c[nH]c3ccccc23)C(=O)O1 |
| InChI | InChI=1S/C28H24ClNO5/c1-28(2)34-26(31)25(27(32)35-28)24(21-15-30-22-9-5-3-7-19(21)22)20-8-4-6-10-23(20)33-16-17-11-13-18(29)14-12-17/h3-15,24-25,30H,16H2,1-2H3/t24-/m0/s1 |
| InChIKey | WOMGIFMRWUFGBQ-DEOSSOPVSA-N |
| XLogP | 5.98 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|