C27H34ClN2+ — CID 2405413
(4R)-4-(2-chlorophenyl)-4'-(2-methylbutan-2-yl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indol-2-ium-1,1'-cyclohexane] (PubChem CID 2405413) has the molecular formula C27H34ClN2+ and a molecular weight of 422.04 g/mol. Its IUPAC name is (4R)-4-(2-chlorophenyl)-4'-(2-methylbutan-2-yl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indol-2-ium-1,1'-cyclohexane].
| Compound Name | (4R)-4-(2-chlorophenyl)-4'-(2-methylbutan-2-yl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indol-2-ium-1,1'-cyclohexane] |
|---|---|
| PubChem CID | 2405413 |
| Molecular Formula | C27H34ClN2+ |
| Molecular Weight | 422.04 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | (4R)-4-(2-chlorophenyl)-4'-(2-methylbutan-2-yl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indol-2-ium-1,1'-cyclohexane] |
| SMILES | CCC(C)(C)C1CCC2(CC1)[NH2+]C[C@@H](c1ccccc1Cl)c1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C27H33ClN2/c1-4-26(2,3)18-13-15-27(16-14-18)25-24(20-10-6-8-12-23(20)30-25)21(17-29-27)19-9-5-7-11-22(19)28/h5-12,18,21,29-30H,4,13-17H2,1-3H3/p+1/t18?,21-,27?/m0/s1 |
| InChIKey | XRISYWSZCMHWOD-XESUAWAGSA-O |
| XLogP | 6.35 |
| TPSA | 32.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.04 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |