C25H20ClFN2S — CID 2094109
(1S,4S)-4-(2-chlorophenyl)-6'-fluorospiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-2,3-dihydrothiochromene] (PubChem CID 2094109) has the molecular formula C25H20ClFN2S and a molecular weight of 434.97 g/mol. Its IUPAC name is (1S,4S)-4-(2-chlorophenyl)-6'-fluorospiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-2,3-dihydrothiochromene].
| Compound Name | (1S,4S)-4-(2-chlorophenyl)-6'-fluorospiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-2,3-dihydrothiochromene] |
|---|---|
| PubChem CID | 2094109 |
| Molecular Formula | C25H20ClFN2S |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | (1S,4S)-4-(2-chlorophenyl)-6'-fluorospiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-2,3-dihydrothiochromene] |
| SMILES | Fc1ccc2c(c1)[C@]1(CCS2)NC[C@H](c2ccccc2Cl)c2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C25H20ClFN2S/c26-20-7-3-1-5-16(20)18-14-28-25(11-12-30-22-10-9-15(27)13-19(22)25)24-23(18)17-6-2-4-8-21(17)29-24/h1-10,13,18,28-29H,11-12,14H2/t18-,25+/m1/s1 |
| InChIKey | JQLRMDZIHIYDEG-CJAUYULYSA-N |
| XLogP | 6.43 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |