C18H13FN2OS — CID 86294695
17-fluoro-21-thia-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15(20),16,18-heptaen-14-one (PubChem CID 86294695) has the molecular formula C18H13FN2OS and a molecular weight of 324.38 g/mol. Its IUPAC name is 17-fluoro-21-thia-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15(20),16,18-heptaen-14-one.
| Compound Name | 17-fluoro-21-thia-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15(20),16,18-heptaen-14-one |
|---|---|
| PubChem CID | 86294695 |
| Molecular Formula | C18H13FN2OS |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 17-fluoro-21-thia-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15(20),16,18-heptaen-14-one |
| SMILES | O=C1c2cc(F)ccc2SC2c3[nH]c4ccccc4c3CCN12 |
| InChI | InChI=1S/C18H13FN2OS/c19-10-5-6-15-13(9-10)17(22)21-8-7-12-11-3-1-2-4-14(11)20-16(12)18(21)23-15/h1-6,9,18,20H,7-8H2 |
| InChIKey | SFNHCGFQHSIASA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|