C22H19N3O — CID 171457808
21-but-2-ynyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15,17,19-heptaen-14-one (PubChem CID 171457808) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is 21-but-2-ynyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15,17,19-heptaen-14-one.
| Compound Name | 21-but-2-ynyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15,17,19-heptaen-14-one |
|---|---|
| PubChem CID | 171457808 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 21-but-2-ynyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15,17,19-heptaen-14-one |
| SMILES | CC#CCN1c2ccccc2C(=O)N2CCc3c([nH]c4ccccc34)C21 |
| InChI | InChI=1S/C22H19N3O/c1-2-3-13-24-19-11-7-5-9-17(19)22(26)25-14-12-16-15-8-4-6-10-18(15)23-20(16)21(24)25/h4-11,21,23H,12-14H2,1H3 |
| InChIKey | WSUIBROYDIQKMS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|