C26H20F3N3O — CID 171457813
21-[[4-(trifluoromethyl)phenyl]methyl]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15,17,19-heptaen-14-one (PubChem CID 171457813) has the molecular formula C26H20F3N3O and a molecular weight of 447.46 g/mol. Its IUPAC name is 21-[[4-(trifluoromethyl)phenyl]methyl]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15,17,19-heptaen-14-one.
| Compound Name | 21-[[4-(trifluoromethyl)phenyl]methyl]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15,17,19-heptaen-14-one |
|---|---|
| PubChem CID | 171457813 |
| Molecular Formula | C26H20F3N3O |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 21-[[4-(trifluoromethyl)phenyl]methyl]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15,17,19-heptaen-14-one |
| SMILES | O=C1c2ccccc2N(Cc2ccc(C(F)(F)F)cc2)C2c3[nH]c4ccccc4c3CCN12 |
| InChI | InChI=1S/C26H20F3N3O/c27-26(28,29)17-11-9-16(10-12-17)15-32-22-8-4-2-6-20(22)25(33)31-14-13-19-18-5-1-3-7-21(18)30-23(19)24(31)32/h1-12,24,30H,13-15H2 |
| InChIKey | RJXWYQPIMZCAHN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|