C19H16FN3O — CID 56967934
16-fluoro-21-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15(20),16,18-heptaen-14-one (PubChem CID 56967934) has the molecular formula C19H16FN3O and a molecular weight of 321.35 g/mol. Its IUPAC name is 16-fluoro-21-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15(20),16,18-heptaen-14-one.
| Compound Name | 16-fluoro-21-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15(20),16,18-heptaen-14-one |
|---|---|
| PubChem CID | 56967934 |
| Molecular Formula | C19H16FN3O |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 16-fluoro-21-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15(20),16,18-heptaen-14-one |
| SMILES | CN1c2cccc(F)c2C(=O)N2CCc3c([nH]c4ccccc34)C21 |
| InChI | InChI=1S/C19H16FN3O/c1-22-15-8-4-6-13(20)16(15)19(24)23-10-9-12-11-5-2-3-7-14(11)21-17(12)18(22)23/h2-8,18,21H,9-10H2,1H3 |
| InChIKey | RQZMSGJKJACPNW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|