C29H29N3O — CID 10252434
(3S,4R)-N,4-diphenylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclohexane]-3-carboxamide (PubChem CID 10252434) has the molecular formula C29H29N3O and a molecular weight of 435.57 g/mol. Its IUPAC name is (3S,4R)-N,4-diphenylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclohexane]-3-carboxamide.
| Compound Name | (3S,4R)-N,4-diphenylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclohexane]-3-carboxamide |
|---|---|
| PubChem CID | 10252434 |
| Molecular Formula | C29H29N3O |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | (3S,4R)-N,4-diphenylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclohexane]-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@H]1NC2(CCCCC2)c2[nH]c3ccccc3c2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C29H29N3O/c33-28(30-21-14-6-2-7-15-21)26-24(20-12-4-1-5-13-20)25-22-16-8-9-17-23(22)31-27(25)29(32-26)18-10-3-11-19-29/h1-2,4-9,12-17,24,26,31-32H,3,10-11,18-19H2,(H,30,33)/t24-,26+/m1/s1 |
| InChIKey | RLOJUZGJBIOYNY-RSXGOPAZSA-N |
| XLogP | 6.07 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |