C26H38N2O2 — CID 102369940
tert-butyl (3R,4S)-4-pentan-3-ylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclohexane]-3-carboxylate (PubChem CID 102369940) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is tert-butyl (3R,4S)-4-pentan-3-ylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclohexane]-3-carboxylate.
| Compound Name | tert-butyl (3R,4S)-4-pentan-3-ylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclohexane]-3-carboxylate |
|---|---|
| PubChem CID | 102369940 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | tert-butyl (3R,4S)-4-pentan-3-ylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclohexane]-3-carboxylate |
| SMILES | CCC(CC)[C@H]1c2c([nH]c3ccccc23)C2(CCCCC2)N[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H38N2O2/c1-6-17(7-2)20-21-18-13-9-10-14-19(18)27-23(21)26(15-11-8-12-16-26)28-22(20)24(29)30-25(3,4)5/h9-10,13-14,17,20,22,27-28H,6-8,11-12,15-16H2,1-5H3/t20-,22+/m0/s1 |
| InChIKey | KDQXOWWURRRELW-RBBKRZOGSA-N |
| XLogP | 6.16 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |