C22H30N2O2 — CID 102369933
tert-butyl (3S,4R)-4-methylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclohexane]-3-carboxylate (PubChem CID 102369933) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is tert-butyl (3S,4R)-4-methylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclohexane]-3-carboxylate.
| Compound Name | tert-butyl (3S,4R)-4-methylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclohexane]-3-carboxylate |
|---|---|
| PubChem CID | 102369933 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | tert-butyl (3S,4R)-4-methylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclohexane]-3-carboxylate |
| SMILES | C[C@@H]1c2c([nH]c3ccccc23)C2(CCCCC2)N[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30N2O2/c1-14-17-15-10-6-7-11-16(15)23-19(17)22(12-8-5-9-13-22)24-18(14)20(25)26-21(2,3)4/h6-7,10-11,14,18,23-24H,5,8-9,12-13H2,1-4H3/t14-,18+/m1/s1 |
| InChIKey | CLOXMABNHRYULQ-KDOFPFPSSA-N |
| XLogP | 4.74 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |