C12H11Cl2NO2 — CID 142294800
(5Z)-5-benzylidene-2-(1,1-dichloroethyl)-1,3-oxazolidin-4-one (PubChem CID 142294800) has the molecular formula C12H11Cl2NO2 and a molecular weight of 272.13 g/mol. Its IUPAC name is (5Z)-5-benzylidene-2-(1,1-dichloroethyl)-1,3-oxazolidin-4-one.
| Compound Name | (5Z)-5-benzylidene-2-(1,1-dichloroethyl)-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 142294800 |
| Molecular Formula | C12H11Cl2NO2 |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | (5Z)-5-benzylidene-2-(1,1-dichloroethyl)-1,3-oxazolidin-4-one |
| SMILES | CC(Cl)(Cl)C1NC(=O)/C(=C/c2ccccc2)O1 |
| InChI | InChI=1S/C12H11Cl2NO2/c1-12(13,14)11-15-10(16)9(17-11)7-8-5-3-2-4-6-8/h2-7,11H,1H3,(H,15,16)/b9-7- |
| InChIKey | FIRQDYADLNFSQT-CLFYSBASSA-N |
| XLogP | 2.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|