C42H36N8 — CID 136785341
naphthalen-1-yl-[(4E,15E)-3,5,14,16-tetramethyl-15-(naphthalen-1-yldiazenyl)-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,15,18,20-decaen-4-yl]diazene (PubChem CID 136785341) has the molecular formula C42H36N8 and a molecular weight of 652.81 g/mol. Its IUPAC name is naphthalen-1-yl-[(4E,15E)-3,5,14,16-tetramethyl-15-(naphthalen-1-yldiazenyl)-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,15,18,20-decaen-4-yl]diazene.
| Compound Name | naphthalen-1-yl-[(4E,15E)-3,5,14,16-tetramethyl-15-(naphthalen-1-yldiazenyl)-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,15,18,20-decaen-4-yl]diazene |
|---|---|
| PubChem CID | 136785341 |
| Molecular Formula | C42H36N8 |
| Molecular Weight | 652.81 g/mol |
| Exact Mass | 652.31 |
| IUPAC Name | naphthalen-1-yl-[(4E,15E)-3,5,14,16-tetramethyl-15-(naphthalen-1-yldiazenyl)-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,15,18,20-decaen-4-yl]diazene |
| SMILES | C/C1=N\c2ccccc2N/C(C)=C(/N=N/c2cccc3ccccc23)C(\C)=N\c2ccccc2N/C(C)=C1/N=N/c1cccc2ccccc12 |
| InChI | InChI=1S/C42H36N8/c1-27-41(49-47-35-25-13-17-31-15-5-7-19-33(31)35)28(2)44-39-23-11-12-24-40(39)46-30(4)42(29(3)45-38-22-10-9-21-37(38)43-27)50-48-36-26-14-18-32-16-6-8-20-34(32)36/h5-26,43,46H,1-4H3/b41-27+,42-30+,44-28+,45-29+,49-47+,50-48+ |
| InChIKey | MZNCYZGGNZKTAF-WNSFEIPNSA-N |
| XLogP | 12.75 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.81 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|