C18H15N3O — CID 135482672
5,7-dimethyl-13H-quinolino[4,3-b][1,5]benzodiazepin-6-one (PubChem CID 135482672) has the molecular formula C18H15N3O and a molecular weight of 289.34 g/mol. Its IUPAC name is 5,7-dimethyl-13H-quinolino[4,3-b][1,5]benzodiazepin-6-one.
| Compound Name | 5,7-dimethyl-13H-quinolino[4,3-b][1,5]benzodiazepin-6-one |
|---|---|
| PubChem CID | 135482672 |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 5,7-dimethyl-13H-quinolino[4,3-b][1,5]benzodiazepin-6-one |
| SMILES | CC1=Nc2ccccc2Nc2c1c(=O)n(C)c1ccccc21 |
| InChI | InChI=1S/C18H15N3O/c1-11-16-17(20-14-9-5-4-8-13(14)19-11)12-7-3-6-10-15(12)21(2)18(16)22/h3-10,20H,1-2H3 |
| InChIKey | XECJZSZMVSYSPM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |