C17H14N2OS — CID 24975744
2,5-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-6-one (PubChem CID 24975744) has the molecular formula C17H14N2OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 2,5-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-6-one.
| Compound Name | 2,5-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-6-one |
|---|---|
| PubChem CID | 24975744 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2,5-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-6-one |
| SMILES | Cc1ccc2c(c1)c1c(c(=O)n2C)Sc2ccccc2N1 |
| InChI | InChI=1S/C17H14N2OS/c1-10-7-8-13-11(9-10)15-16(17(20)19(13)2)21-14-6-4-3-5-12(14)18-15/h3-9,18H,1-2H3 |
| InChIKey | XPIUXCVCSLBQDJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |