C13H8F3NS — CID 69485794
2,3,4-trifluoro-1-methyl-10H-phenothiazine (PubChem CID 69485794) has the molecular formula C13H8F3NS and a molecular weight of 267.27 g/mol. Its IUPAC name is 2,3,4-trifluoro-1-methyl-10H-phenothiazine.
| Compound Name | 2,3,4-trifluoro-1-methyl-10H-phenothiazine |
|---|---|
| PubChem CID | 69485794 |
| Molecular Formula | C13H8F3NS |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2,3,4-trifluoro-1-methyl-10H-phenothiazine |
| SMILES | Cc1c(F)c(F)c(F)c2c1Nc1ccccc1S2 |
| InChI | InChI=1S/C13H8F3NS/c1-6-9(14)10(15)11(16)13-12(6)17-7-4-2-3-5-8(7)18-13/h2-5,17H,1H3 |
| InChIKey | DAGYILWONQXQMA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|