C15H14N4O2S — CID 135481618
4-hydroxy-1-methyl-3-(5-methyl-3-sulfanylidene-1,2-dihydro-1,2,4-triazepin-7-yl)quinolin-2-one (PubChem CID 135481618) has the molecular formula C15H14N4O2S and a molecular weight of 314.37 g/mol. Its IUPAC name is 4-hydroxy-1-methyl-3-(5-methyl-3-sulfanylidene-1,2-dihydro-1,2,4-triazepin-7-yl)quinolin-2-one.
| Compound Name | 4-hydroxy-1-methyl-3-(5-methyl-3-sulfanylidene-1,2-dihydro-1,2,4-triazepin-7-yl)quinolin-2-one |
|---|---|
| PubChem CID | 135481618 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 4-hydroxy-1-methyl-3-(5-methyl-3-sulfanylidene-1,2-dihydro-1,2,4-triazepin-7-yl)quinolin-2-one |
| SMILES | CC1=NC(=S)NNC(c2c(O)c3ccccc3n(C)c2=O)=C1 |
| InChI | InChI=1S/C15H14N4O2S/c1-8-7-10(17-18-15(22)16-8)12-13(20)9-5-3-4-6-11(9)19(2)14(12)21/h3-7,17,20H,1-2H3,(H,18,22) |
| InChIKey | HCVAVKLUPCBRQC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|