About CID 175078571
CID 175078571 (PubChem CID 175078571) has the molecular formula C20H14BN2
and a molecular weight of 293.16 g/mol.
Molecular Properties
| Compound Name | CID 175078571 |
| PubChem CID | 175078571 |
| Molecular Formula | C20H14BN2 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | — |
| SMILES | [B].c1ccc2c(/N=N/c3cccc4ccccc34)cccc2c1 |
| InChI | InChI=1S/C20H14N2.B/c1-3-11-17-15(7-1)9-5-13-19(17)21-22-20-14-6-10-16-8-2-4-12-18(16)20;/h1-14H;/b22-21+; |
| InChIKey | RCYKHTUDEKGSPC-QUABFQRHSA-N |
| XLogP | 6.03 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175078571 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175078571?
The IUPAC name of CID 175078571 (CID 175078571) is not available.
What is the SMILES notation for CID 175078571?
The canonical SMILES for CID 175078571 is [B].c1ccc2c(/N=N/c3cccc4ccccc34)cccc2c1.
What is the InChIKey of CID 175078571?
The InChIKey is RCYKHTUDEKGSPC-QUABFQRHSA-N. The full InChI is InChI=1S/C20H14N2.B/c1-3-11-17-15(7-1)9-5-13-19(17)21-22-20-14-6-10-16-8-2-4-12-18(16)20;/h1-14H;/b22-21+;.
What are the key properties of CID 175078571?
CID 175078571 has a molecular weight of 293.16 g/mol, XLogP of 6.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175078571 is sourced from PubChem (CID 175078571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).