C20H14N2O6S2 — CID 87303681
3-(naphthalen-1-yldiazenyl)naphthalene-1,2-disulfonic acid (PubChem CID 87303681) has the molecular formula C20H14N2O6S2 and a molecular weight of 442.47 g/mol. Its IUPAC name is 3-(naphthalen-1-yldiazenyl)naphthalene-1,2-disulfonic acid.
| Compound Name | 3-(naphthalen-1-yldiazenyl)naphthalene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 87303681 |
| Molecular Formula | C20H14N2O6S2 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 3-(naphthalen-1-yldiazenyl)naphthalene-1,2-disulfonic acid |
| SMILES | O=S(=O)(O)c1c(/N=N/c2cccc3ccccc23)cc2ccccc2c1S(=O)(=O)O |
| InChI | InChI=1S/C20H14N2O6S2/c23-29(24,25)19-16-10-4-2-7-14(16)12-18(20(19)30(26,27)28)22-21-17-11-5-8-13-6-1-3-9-15(13)17/h1-12H,(H,23,24,25)(H,26,27,28)/b22-21+ |
| InChIKey | PTJFLDZUCKLALG-QURGRASLSA-N |
| XLogP | 4.90 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|