C18H14ClN3 — CID 87287590
1-chloro-4-(2,5-dimethyl-1H-indol-3-yl)phthalazine (PubChem CID 87287590) has the molecular formula C18H14ClN3 and a molecular weight of 307.78 g/mol. Its IUPAC name is 1-chloro-4-(2,5-dimethyl-1H-indol-3-yl)phthalazine.
| Compound Name | 1-chloro-4-(2,5-dimethyl-1H-indol-3-yl)phthalazine |
|---|---|
| PubChem CID | 87287590 |
| Molecular Formula | C18H14ClN3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 1-chloro-4-(2,5-dimethyl-1H-indol-3-yl)phthalazine |
| SMILES | Cc1ccc2[nH]c(C)c(-c3nnc(Cl)c4ccccc34)c2c1 |
| InChI | InChI=1S/C18H14ClN3/c1-10-7-8-15-14(9-10)16(11(2)20-15)17-12-5-3-4-6-13(12)18(19)22-21-17/h3-9,20H,1-2H3 |
| InChIKey | RJYSBVSILFWDFE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |