C11H8ClN3 — CID 71596891
1-chloro-4-methyl-5H-pyridazino[4,5-b]indole (PubChem CID 71596891) has the molecular formula C11H8ClN3 and a molecular weight of 217.66 g/mol. Its IUPAC name is 1-chloro-4-methyl-5H-pyridazino[4,5-b]indole.
| Compound Name | 1-chloro-4-methyl-5H-pyridazino[4,5-b]indole |
|---|---|
| PubChem CID | 71596891 |
| Molecular Formula | C11H8ClN3 |
| Molecular Weight | 217.66 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 1-chloro-4-methyl-5H-pyridazino[4,5-b]indole |
| SMILES | Cc1nnc(Cl)c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C11H8ClN3/c1-6-10-9(11(12)15-14-6)7-4-2-3-5-8(7)13-10/h2-5,13H,1H3 |
| InChIKey | FZSYCCCULCGQRO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.66 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |