C13H9NO2 — CID 53244095
6-methyl-9H-carbazole-1,4-dione (PubChem CID 53244095) has the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 6-methyl-9H-carbazole-1,4-dione.
| Compound Name | 6-methyl-9H-carbazole-1,4-dione |
|---|---|
| PubChem CID | 53244095 |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 6-methyl-9H-carbazole-1,4-dione |
| SMILES | Cc1ccc2[nH]c3c(c2c1)C(=O)C=CC3=O |
| InChI | InChI=1S/C13H9NO2/c1-7-2-3-9-8(6-7)12-10(15)4-5-11(16)13(12)14-9/h2-6,14H,1H3 |
| InChIKey | SHHGRXCEECWHNQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|