C15H8Cl2N2O2S — CID 3474348
3,7-bis(4-chlorophenyl)-2,8-dioxa-1λ4-thia-4,6-diazabicyclo[3.3.0]octa-1(5),3,6-triene (PubChem CID 3474348) has the molecular formula C15H8Cl2N2O2S and a molecular weight of 351.21 g/mol. Its IUPAC name is 3,7-bis(4-chlorophenyl)-2,8-dioxa-1λ4-thia-4,6-diazabicyclo[3.3.0]octa-1(5),3,6-triene.
| Compound Name | 3,7-bis(4-chlorophenyl)-2,8-dioxa-1λ4-thia-4,6-diazabicyclo[3.3.0]octa-1(5),3,6-triene |
|---|---|
| PubChem CID | 3474348 |
| Molecular Formula | C15H8Cl2N2O2S |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 3,7-bis(4-chlorophenyl)-2,8-dioxa-1λ4-thia-4,6-diazabicyclo[3.3.0]octa-1(5),3,6-triene |
| SMILES | Clc1ccc(C2=NC3=S(O2)OC(c2ccc(Cl)cc2)=N3)cc1 |
| InChI | InChI=1S/C15H8Cl2N2O2S/c16-11-5-1-9(2-6-11)13-18-15-19-14(21-22(15)20-13)10-3-7-12(17)8-4-10/h1-8H |
| InChIKey | YNYVRBIYICHBMT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|