About benzoyl iodide;furan
benzoyl iodide;furan (PubChem CID 174563356) has the molecular formula C11H9IO2
and a molecular weight of 300.10 g/mol. Its IUPAC name is benzoyl iodide;furan.
Molecular Properties
| Compound Name | benzoyl iodide;furan |
| PubChem CID | 174563356 |
| Molecular Formula | C11H9IO2 |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | benzoyl iodide;furan |
| SMILES | O=C(I)c1ccccc1.c1ccoc1 |
| InChI | InChI=1S/C7H5IO.C4H4O/c8-7(9)6-4-2-1-3-5-6;1-2-4-5-3-1/h1-5H;1-4H |
| InChIKey | WFDYCEVNUWNKHF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze benzoyl iodide;furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyl iodide;furan?
The IUPAC name of benzoyl iodide;furan (CID 174563356) is benzoyl iodide;furan.
What is the SMILES notation for benzoyl iodide;furan?
The canonical SMILES for benzoyl iodide;furan is O=C(I)c1ccccc1.c1ccoc1.
What is the InChIKey of benzoyl iodide;furan?
The InChIKey is WFDYCEVNUWNKHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5IO.C4H4O/c8-7(9)6-4-2-1-3-5-6;1-2-4-5-3-1/h1-5H;1-4H.
What are the key properties of benzoyl iodide;furan?
benzoyl iodide;furan has a molecular weight of 300.10 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl iodide;furan is sourced from PubChem (CID 174563356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).