About 2,5-bis(4-phenylphenyl)-3H-1,2,4-oxadiazole
2,5-bis(4-phenylphenyl)-3H-1,2,4-oxadiazole (PubChem CID 70116871) has the molecular formula C26H20N2O
and a molecular weight of 376.46 g/mol. Its IUPAC name is 2,5-bis(4-phenylphenyl)-3H-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 2,5-bis(4-phenylphenyl)-3H-1,2,4-oxadiazole |
| PubChem CID | 70116871 |
| Molecular Formula | C26H20N2O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2,5-bis(4-phenylphenyl)-3H-1,2,4-oxadiazole |
| SMILES | c1ccc(-c2ccc(C3=NCN(c4ccc(-c5ccccc5)cc4)O3)cc2)cc1 |
| InChI | InChI=1S/C26H20N2O/c1-3-7-20(8-4-1)22-11-13-24(14-12-22)26-27-19-28(29-26)25-17-15-23(16-18-25)21-9-5-2-6-10-21/h1-18H,19H2 |
| InChIKey | GZSMZQVCIYCXHH-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-bis(4-phenylphenyl)-3H-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(4-phenylphenyl)-3H-1,2,4-oxadiazole?
The IUPAC name of 2,5-bis(4-phenylphenyl)-3H-1,2,4-oxadiazole (CID 70116871) is 2,5-bis(4-phenylphenyl)-3H-1,2,4-oxadiazole.
What is the SMILES notation for 2,5-bis(4-phenylphenyl)-3H-1,2,4-oxadiazole?
The canonical SMILES for 2,5-bis(4-phenylphenyl)-3H-1,2,4-oxadiazole is c1ccc(-c2ccc(C3=NCN(c4ccc(-c5ccccc5)cc4)O3)cc2)cc1.
What is the InChIKey of 2,5-bis(4-phenylphenyl)-3H-1,2,4-oxadiazole?
The InChIKey is GZSMZQVCIYCXHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N2O/c1-3-7-20(8-4-1)22-11-13-24(14-12-22)26-27-19-28(29-26)25-17-15-23(16-18-25)21-9-5-2-6-10-21/h1-18H,19H2.
What are the key properties of 2,5-bis(4-phenylphenyl)-3H-1,2,4-oxadiazole?
2,5-bis(4-phenylphenyl)-3H-1,2,4-oxadiazole has a molecular weight of 376.46 g/mol, XLogP of 6.18, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(4-phenylphenyl)-3H-1,2,4-oxadiazole is sourced from PubChem (CID 70116871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).