C24H18I2 — CID 102480003
(2Z,3Z)-2,3-bis[iodo(phenyl)methylidene]-1,4-dihydronaphthalene (PubChem CID 102480003) has the molecular formula C24H18I2 and a molecular weight of 560.22 g/mol. Its IUPAC name is (2Z,3Z)-2,3-bis[iodo(phenyl)methylidene]-1,4-dihydronaphthalene.
| Compound Name | (2Z,3Z)-2,3-bis[iodo(phenyl)methylidene]-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 102480003 |
| Molecular Formula | C24H18I2 |
| Molecular Weight | 560.22 g/mol |
| Exact Mass | 559.95 |
| IUPAC Name | (2Z,3Z)-2,3-bis[iodo(phenyl)methylidene]-1,4-dihydronaphthalene |
| SMILES | I/C(=C1/Cc2ccccc2C/C1=C(/I)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H18I2/c25-23(17-9-3-1-4-10-17)21-15-19-13-7-8-14-20(19)16-22(21)24(26)18-11-5-2-6-12-18/h1-14H,15-16H2/b23-21-,24-22- |
| InChIKey | PUPLGQPRGVHJNH-SXAUZNKPSA-N |
| XLogP | 7.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.22 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|