C8H13NO — CID 143326337
(3aS)-2-methyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole (PubChem CID 143326337) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (3aS)-2-methyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole.
| Compound Name | (3aS)-2-methyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 143326337 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (3aS)-2-methyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole |
| SMILES | CC1=N[C@H]2CCCCC2O1 |
| InChI | InChI=1S/C8H13NO/c1-6-9-7-4-2-3-5-8(7)10-6/h7-8H,2-5H2,1H3/t7-,8?/m0/s1 |
| InChIKey | DAHOOHZYUHETID-JAMMHHFISA-N |
| XLogP | 1.75 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |