C9H16N2O — CID 15939239
(3aS,7aS)-N,N-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-amine (PubChem CID 15939239) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is (3aS,7aS)-N,N-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-amine.
| Compound Name | (3aS,7aS)-N,N-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 15939239 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (3aS,7aS)-N,N-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-amine |
| SMILES | CN(C)C1=N[C@H]2CCCC[C@@H]2O1 |
| InChI | InChI=1S/C9H16N2O/c1-11(2)9-10-7-5-3-4-6-8(7)12-9/h7-8H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | BOQMNQXGUGSTNB-YUMQZZPRSA-N |
| XLogP | 1.25 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |