5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid

C10H15NO3 — CID 115059906

IUPAC5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid
SMILESCC1=NC(C(=O)O)C(C2CCCC2)O1
InChIInChI=1S/C10H15NO3/c1-6-11-8(10(12)13)9(14-6)7-4-2-3-5-7/h7-9H,2-5H2,1H3,(H,12,13)
InChIKeyRZSOMFBFZAZLTL-UHFFFAOYSA-N
MW197.23 g/mol
LogP1.45
Rot. Bonds2

About 5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid

5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid (PubChem CID 115059906) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid.

Molecular Properties

Compound Name5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid
PubChem CID115059906
Molecular FormulaC10H15NO3
Molecular Weight197.23 g/mol
Exact Mass197.11
IUPAC Name5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid
SMILESCC1=NC(C(=O)O)C(C2CCCC2)O1
InChIInChI=1S/C10H15NO3/c1-6-11-8(10(12)13)9(14-6)7-4-2-3-5-7/h7-9H,2-5H2,1H3,(H,12,13)
InChIKeyRZSOMFBFZAZLTL-UHFFFAOYSA-N
XLogP1.45
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.23
LogP ≤ 51.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid (CID 115059906) is 5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid is CC1=NC(C(=O)O)C(C2CCCC2)O1.
What is the InChIKey of 5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
The InChIKey is RZSOMFBFZAZLTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-6-11-8(10(12)13)9(14-6)7-4-2-3-5-7/h7-9H,2-5H2,1H3,(H,12,13).
What are the key properties of 5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid has a molecular weight of 197.23 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentyl-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 115059906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).