C10H13NO3 — CID 67939249
2-methyl-5-penta-1,4-dien-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid (PubChem CID 67939249) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-methyl-5-penta-1,4-dien-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-methyl-5-penta-1,4-dien-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67939249 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 2-methyl-5-penta-1,4-dien-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid |
| SMILES | C=CCC(=C)C1OC(C)=NC1C(=O)O |
| InChI | InChI=1S/C10H13NO3/c1-4-5-6(2)9-8(10(12)13)11-7(3)14-9/h4,8-9H,1-2,5H2,3H3,(H,12,13) |
| InChIKey | QNKWEBLWZVAPTM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|