C11H15NO2 — CID 82281613
2-(3-methoxyphenyl)-5-methyl-1,3-oxazolidine (PubChem CID 82281613) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-5-methyl-1,3-oxazolidine.
| Compound Name | 2-(3-methoxyphenyl)-5-methyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 82281613 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-(3-methoxyphenyl)-5-methyl-1,3-oxazolidine |
| SMILES | COc1cccc(C2NCC(C)O2)c1 |
| InChI | InChI=1S/C11H15NO2/c1-8-7-12-11(14-8)9-4-3-5-10(6-9)13-2/h3-6,8,11-12H,7H2,1-2H3 |
| InChIKey | USNLLUROTXGAHP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |