C14H19BO3 — CID 89046388
CID 89046388 (PubChem CID 89046388) has the molecular formula C14H19BO3 and a molecular weight of 246.12 g/mol.
| Compound Name | CID 89046388 |
|---|---|
| PubChem CID | 89046388 |
| Molecular Formula | C14H19BO3 |
| Molecular Weight | 246.12 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | — |
| SMILES | [B]c1c(OC)cccc1[C@@H](CCC)OCC1CO1 |
| InChI | InChI=1S/C14H19BO3/c1-3-5-12(18-9-10-8-17-10)11-6-4-7-13(16-2)14(11)15/h4,6-7,10,12H,3,5,8-9H2,1-2H3/t10?,12-/m1/s1 |
| InChIKey | AKQYDTHJXDHNCJ-TVKKRMFBSA-N |
| XLogP | 1.75 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.12 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|