C25H30O5 — CID 174834639
[2,3-bis[1-(oxiran-2-ylmethoxy)propyl]phenyl]-phenylmethanone (PubChem CID 174834639) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is [2,3-bis[1-(oxiran-2-ylmethoxy)propyl]phenyl]-phenylmethanone.
| Compound Name | [2,3-bis[1-(oxiran-2-ylmethoxy)propyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 174834639 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | [2,3-bis[1-(oxiran-2-ylmethoxy)propyl]phenyl]-phenylmethanone |
| SMILES | CCC(OCC1CO1)c1cccc(C(=O)c2ccccc2)c1C(CC)OCC1CO1 |
| InChI | InChI=1S/C25H30O5/c1-3-22(29-15-18-13-27-18)20-11-8-12-21(25(26)17-9-6-5-7-10-17)24(20)23(4-2)30-16-19-14-28-19/h5-12,18-19,22-23H,3-4,13-16H2,1-2H3 |
| InChIKey | AKCPBGUQXPLDIM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 60.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|