C22H27I3O7 — CID 158847630
1-O-(oxiran-2-ylmethyl) 5-O-[4-oxo-4-(2,4,6-triiodophenoxy)butyl] 2,2,4,4-tetramethylpentanedioate (PubChem CID 158847630) has the molecular formula C22H27I3O7 and a molecular weight of 784.16 g/mol. Its IUPAC name is 1-O-(oxiran-2-ylmethyl) 5-O-[4-oxo-4-(2,4,6-triiodophenoxy)butyl] 2,2,4,4-tetramethylpentanedioate.
| Compound Name | 1-O-(oxiran-2-ylmethyl) 5-O-[4-oxo-4-(2,4,6-triiodophenoxy)butyl] 2,2,4,4-tetramethylpentanedioate |
|---|---|
| PubChem CID | 158847630 |
| Molecular Formula | C22H27I3O7 |
| Molecular Weight | 784.16 g/mol |
| Exact Mass | 783.89 |
| IUPAC Name | 1-O-(oxiran-2-ylmethyl) 5-O-[4-oxo-4-(2,4,6-triiodophenoxy)butyl] 2,2,4,4-tetramethylpentanedioate |
| SMILES | CC(C)(CC(C)(C)C(=O)OCC1CO1)C(=O)OCCCC(=O)Oc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C22H27I3O7/c1-21(2,12-22(3,4)20(28)31-11-14-10-30-14)19(27)29-7-5-6-17(26)32-18-15(24)8-13(23)9-16(18)25/h8-9,14H,5-7,10-12H2,1-4H3 |
| InChIKey | KMXXNISNBYRSKE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.16 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|