C22H29IO7 — CID 158847629
1-O-[4-(4-iodophenoxy)-4-oxobutyl] 5-O-(oxiran-2-ylmethyl) 2,2,4,4-tetramethylpentanedioate (PubChem CID 158847629) has the molecular formula C22H29IO7 and a molecular weight of 532.37 g/mol. Its IUPAC name is 1-O-[4-(4-iodophenoxy)-4-oxobutyl] 5-O-(oxiran-2-ylmethyl) 2,2,4,4-tetramethylpentanedioate.
| Compound Name | 1-O-[4-(4-iodophenoxy)-4-oxobutyl] 5-O-(oxiran-2-ylmethyl) 2,2,4,4-tetramethylpentanedioate |
|---|---|
| PubChem CID | 158847629 |
| Molecular Formula | C22H29IO7 |
| Molecular Weight | 532.37 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | 1-O-[4-(4-iodophenoxy)-4-oxobutyl] 5-O-(oxiran-2-ylmethyl) 2,2,4,4-tetramethylpentanedioate |
| SMILES | CC(C)(CC(C)(C)C(=O)OCC1CO1)C(=O)OCCCC(=O)Oc1ccc(I)cc1 |
| InChI | InChI=1S/C22H29IO7/c1-21(2,14-22(3,4)20(26)29-13-17-12-28-17)19(25)27-11-5-6-18(24)30-16-9-7-15(23)8-10-16/h7-10,17H,5-6,11-14H2,1-4H3 |
| InChIKey | QAEUXFGHKJRSCG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|