C30H50O9 — CID 167624856
4-hydroxybutyl 2-methylbutanoate;(4-hydroxyphenyl) 2,2-dimethylbutanoate;oxiran-2-ylmethyl 2,2-dimethylbutanoate (PubChem CID 167624856) has the molecular formula C30H50O9 and a molecular weight of 554.72 g/mol. Its IUPAC name is 4-hydroxybutyl 2-methylbutanoate;(4-hydroxyphenyl) 2,2-dimethylbutanoate;oxiran-2-ylmethyl 2,2-dimethylbutanoate.
| Compound Name | 4-hydroxybutyl 2-methylbutanoate;(4-hydroxyphenyl) 2,2-dimethylbutanoate;oxiran-2-ylmethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 167624856 |
| Molecular Formula | C30H50O9 |
| Molecular Weight | 554.72 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | 4-hydroxybutyl 2-methylbutanoate;(4-hydroxyphenyl) 2,2-dimethylbutanoate;oxiran-2-ylmethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC1CO1.CCC(C)(C)C(=O)Oc1ccc(O)cc1.CCC(C)C(=O)OCCCCO |
| InChI | InChI=1S/C12H16O3.C9H16O3.C9H18O3/c1-4-12(2,3)11(14)15-10-7-5-9(13)6-8-10;1-4-9(2,3)8(10)12-6-7-5-11-7;1-3-8(2)9(11)12-7-5-4-6-10/h5-8,13H,4H2,1-3H3;7H,4-6H2,1-3H3;8,10H,3-7H2,1-2H3 |
| InChIKey | MYNZNJGEDOKYBB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.72 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|