C18H22I3NO4 — CID 154609212
4-O-(2-piperidin-4-ylpropan-2-yl) 1-O-(2,4,6-triiodophenyl) butanedioate (PubChem CID 154609212) has the molecular formula C18H22I3NO4 and a molecular weight of 697.09 g/mol. Its IUPAC name is 4-O-(2-piperidin-4-ylpropan-2-yl) 1-O-(2,4,6-triiodophenyl) butanedioate.
| Compound Name | 4-O-(2-piperidin-4-ylpropan-2-yl) 1-O-(2,4,6-triiodophenyl) butanedioate |
|---|---|
| PubChem CID | 154609212 |
| Molecular Formula | C18H22I3NO4 |
| Molecular Weight | 697.09 g/mol |
| Exact Mass | 696.87 |
| IUPAC Name | 4-O-(2-piperidin-4-ylpropan-2-yl) 1-O-(2,4,6-triiodophenyl) butanedioate |
| SMILES | CC(C)(OC(=O)CCC(=O)Oc1c(I)cc(I)cc1I)C1CCNCC1 |
| InChI | InChI=1S/C18H22I3NO4/c1-18(2,11-5-7-22-8-6-11)26-16(24)4-3-15(23)25-17-13(20)9-12(19)10-14(17)21/h9-11,22H,3-8H2,1-2H3 |
| InChIKey | NGHVKMLSMXBXBS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.09 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|