C23H42N2O4 — CID 155075566
bis(2-piperidin-4-ylpropan-2-yl) 2,2-dimethylpentanedioate (PubChem CID 155075566) has the molecular formula C23H42N2O4 and a molecular weight of 410.60 g/mol. Its IUPAC name is bis(2-piperidin-4-ylpropan-2-yl) 2,2-dimethylpentanedioate.
| Compound Name | bis(2-piperidin-4-ylpropan-2-yl) 2,2-dimethylpentanedioate |
|---|---|
| PubChem CID | 155075566 |
| Molecular Formula | C23H42N2O4 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | bis(2-piperidin-4-ylpropan-2-yl) 2,2-dimethylpentanedioate |
| SMILES | CC(C)(CCC(=O)OC(C)(C)C1CCNCC1)C(=O)OC(C)(C)C1CCNCC1 |
| InChI | InChI=1S/C23H42N2O4/c1-21(2,20(27)29-23(5,6)18-10-15-25-16-11-18)12-7-19(26)28-22(3,4)17-8-13-24-14-9-17/h17-18,24-25H,7-16H2,1-6H3 |
| InChIKey | UQKMTSWEFSYLLT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |